C12H23ClN2O4S — CID 131734148
ethyl (2R)-2-acetamido-3-[(2S)-2-amino-3-methylbutanoyl]sulfanylpropanoate;hydrochloride (PubChem CID 131734148) has the molecular formula C12H23ClN2O4S and a molecular weight of 326.85 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3-[(2S)-2-amino-3-methylbutanoyl]sulfanylpropanoate;hydrochloride.
| Compound Name | ethyl (2R)-2-acetamido-3-[(2S)-2-amino-3-methylbutanoyl]sulfanylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 131734148 |
| Molecular Formula | C12H23ClN2O4S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | ethyl (2R)-2-acetamido-3-[(2S)-2-amino-3-methylbutanoyl]sulfanylpropanoate;hydrochloride |
| SMILES | CCOC(=O)[C@H](CSC(=O)[C@@H](N)C(C)C)NC(C)=O.Cl |
| InChI | InChI=1S/C12H22N2O4S.ClH/c1-5-18-11(16)9(14-8(4)15)6-19-12(17)10(13)7(2)3;/h7,9-10H,5-6,13H2,1-4H3,(H,14,15);1H/t9-,10-;/m0./s1 |
| InChIKey | NFGMVBLNNOHZQT-IYPAPVHQSA-N |
| XLogP | 0.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|