C20H30N2O6S2 — CID 24859491
ethyl (2R)-2-acetamido-3-[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]sulfanylpropanoate (PubChem CID 24859491) has the molecular formula C20H30N2O6S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3-[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-acetamido-3-[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 24859491 |
| Molecular Formula | C20H30N2O6S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethyl (2R)-2-acetamido-3-[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CSC(=O)[C@H](CC(C)C)NS(=O)(=O)c1ccc(C)cc1)NC(C)=O |
| InChI | InChI=1S/C20H30N2O6S2/c1-6-28-19(24)18(21-15(5)23)12-29-20(25)17(11-13(2)3)22-30(26,27)16-9-7-14(4)8-10-16/h7-10,13,17-18,22H,6,11-12H2,1-5H3,(H,21,23)/t17-,18-/m0/s1 |
| InChIKey | MOBOZHICCVDAGA-ROUUACIJSA-N |
| XLogP | 2.02 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|