C16H25NO7S — CID 126705110
[(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxymethyl cyclohexanecarboxylate (PubChem CID 126705110) has the molecular formula C16H25NO7S and a molecular weight of 375.44 g/mol. Its IUPAC name is [(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxymethyl cyclohexanecarboxylate.
| Compound Name | [(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxymethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 126705110 |
| Molecular Formula | C16H25NO7S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxymethyl cyclohexanecarboxylate |
| SMILES | CCOC(=O)[C@H](CSC(=O)OCOC(=O)C1CCCCC1)NC(C)=O |
| InChI | InChI=1S/C16H25NO7S/c1-3-22-15(20)13(17-11(2)18)9-25-16(21)24-10-23-14(19)12-7-5-4-6-8-12/h12-13H,3-10H2,1-2H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | ZUUDIPVYZXRDOM-ZDUSSCGKSA-N |
| XLogP | 2.01 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|