C11H16N2O5S2 — CID 118067296
ethyl (2R)-2-acetamido-3-(2-oxo-1,3-thiazolidine-4-carbonyl)sulfanylpropanoate (PubChem CID 118067296) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3-(2-oxo-1,3-thiazolidine-4-carbonyl)sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-acetamido-3-(2-oxo-1,3-thiazolidine-4-carbonyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 118067296 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | ethyl (2R)-2-acetamido-3-(2-oxo-1,3-thiazolidine-4-carbonyl)sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CSC(=O)C1CSC(=O)N1)NC(C)=O |
| InChI | InChI=1S/C11H16N2O5S2/c1-3-18-9(15)7(12-6(2)14)4-19-10(16)8-5-20-11(17)13-8/h7-8H,3-5H2,1-2H3,(H,12,14)(H,13,17)/t7-,8?/m0/s1 |
| InChIKey | KXCAVJHPOSMYJG-JAMMHHFISA-N |
| XLogP | 0.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|