C9H12N2O5S2 — CID 118062157
(2R)-2-acetamido-3-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]sulfanylpropanoic acid (PubChem CID 118062157) has the molecular formula C9H12N2O5S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 118062157 |
| Molecular Formula | C9H12N2O5S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | (2R)-2-acetamido-3-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC(=O)[C@H]1CSC(=O)N1)C(=O)O |
| InChI | InChI=1S/C9H12N2O5S2/c1-4(12)10-5(7(13)14)2-17-8(15)6-3-18-9(16)11-6/h5-6H,2-3H2,1H3,(H,10,12)(H,11,16)(H,13,14)/t5-,6+/m0/s1 |
| InChIKey | LGYJWCZFAPBAJP-NTSWFWBYSA-N |
| XLogP | -0.34 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|