C13H23NO3S — CID 107774621
(2R)-2-acetamido-3-(3,4-dimethylcyclohexyl)sulfanylpropanoic acid (PubChem CID 107774621) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(3,4-dimethylcyclohexyl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-(3,4-dimethylcyclohexyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107774621 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (2R)-2-acetamido-3-(3,4-dimethylcyclohexyl)sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC1CCC(C)C(C)C1)C(=O)O |
| InChI | InChI=1S/C13H23NO3S/c1-8-4-5-11(6-9(8)2)18-7-12(13(16)17)14-10(3)15/h8-9,11-12H,4-7H2,1-3H3,(H,14,15)(H,16,17)/t8?,9?,11?,12-/m0/s1 |
| InChIKey | WKXCTXWJDDGRJD-AGNDBTCWSA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |