C16H26N2O7S2 — CID 122630814
(2R)-2-acetamido-3-[[5-[[(2R)-2-acetamido-2-carboxyethyl]sulfanylmethyl]oxolan-2-yl]methylsulfanyl]propanoic acid (PubChem CID 122630814) has the molecular formula C16H26N2O7S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[[5-[[(2R)-2-acetamido-2-carboxyethyl]sulfanylmethyl]oxolan-2-yl]methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[[5-[[(2R)-2-acetamido-2-carboxyethyl]sulfanylmethyl]oxolan-2-yl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 122630814 |
| Molecular Formula | C16H26N2O7S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (2R)-2-acetamido-3-[[5-[[(2R)-2-acetamido-2-carboxyethyl]sulfanylmethyl]oxolan-2-yl]methylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCC1CCC(CSC[C@H](NC(C)=O)C(=O)O)O1)C(=O)O |
| InChI | InChI=1S/C16H26N2O7S2/c1-9(19)17-13(15(21)22)7-26-5-11-3-4-12(25-11)6-27-8-14(16(23)24)18-10(2)20/h11-14H,3-8H2,1-2H3,(H,17,19)(H,18,20)(H,21,22)(H,23,24)/t11?,12?,13-,14-/m0/s1 |
| InChIKey | HIJOYXVUPFPKRR-HOAMVYINSA-N |
| XLogP | 0.18 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |