C9H14N2O4S — CID 80539296
2-methyl-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid (PubChem CID 80539296) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-methyl-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid.
| Compound Name | 2-methyl-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 80539296 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-methyl-4-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]butanoic acid |
| SMILES | CC(CCNC(=O)C1CSC(=O)N1)C(=O)O |
| InChI | InChI=1S/C9H14N2O4S/c1-5(8(13)14)2-3-10-7(12)6-4-16-9(15)11-6/h5-6H,2-4H2,1H3,(H,10,12)(H,11,15)(H,13,14) |
| InChIKey | HPRANZIDINUUOX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|