C8H14N2O3S — CID 65109815
N-(2-hydroxy-2-methylpropyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 65109815) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 65109815 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)(O)CNC(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C8H14N2O3S/c1-8(2,13)4-9-6(11)5-3-14-7(12)10-5/h5,13H,3-4H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | OZSJXIHTCBKYOG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|