C10H20ClN3O2S — CID 119608653
(4R)-N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119608653) has the molecular formula C10H20ClN3O2S and a molecular weight of 281.81 g/mol. Its IUPAC name is (4R)-N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | (4R)-N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119608653 |
| Molecular Formula | C10H20ClN3O2S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (4R)-N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)[C@@H]1CSC(=O)N1.Cl |
| InChI | InChI=1S/C10H19N3O2S.ClH/c1-6(2)10(3,5-11)13-8(14)7-4-16-9(15)12-7;/h6-7H,4-5,11H2,1-3H3,(H,12,15)(H,13,14);1H/t7-,10?;/m0./s1 |
| InChIKey | BOFZXAUVZOQSEL-WFWYDLLNSA-N |
| XLogP | 0.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|