C11H21N3O2S — CID 119600037
(4R)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 119600037) has the molecular formula C11H21N3O2S and a molecular weight of 259.38 g/mol. Its IUPAC name is (4R)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119600037 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (4R)-N-(1-amino-2,4-dimethylpentan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)[C@@H]1CSC(=O)N1 |
| InChI | InChI=1S/C11H21N3O2S/c1-7(2)4-11(3,6-12)14-9(15)8-5-17-10(16)13-8/h7-8H,4-6,12H2,1-3H3,(H,13,16)(H,14,15)/t8-,11?/m0/s1 |
| InChIKey | NLXYBSTWPKCJHZ-YMNIQAILSA-N |
| XLogP | 0.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|