C8H15N3O2S — CID 65193356
N-(1-aminobutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 65193356) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(1-aminobutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 65193356 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-(1-aminobutan-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CCC(CN)NC(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C8H15N3O2S/c1-2-5(3-9)10-7(12)6-4-14-8(13)11-6/h5-6H,2-4,9H2,1H3,(H,10,12)(H,11,13) |
| InChIKey | FUWCMPMRRCASAN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|