C8H12N2O2S — CID 130977762
N-(cyclopropylmethyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 130977762) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 130977762 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-(cyclopropylmethyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)NCC2CC2)CS1 |
| InChI | InChI=1S/C8H12N2O2S/c11-7(9-3-5-1-2-5)6-4-13-8(12)10-6/h5-6H,1-4H2,(H,9,11)(H,10,12) |
| InChIKey | NHRNVIZCLKJNGU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|