C6H9N5O2S — CID 61342320
N-(2-azidoethyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 61342320) has the molecular formula C6H9N5O2S and a molecular weight of 215.24 g/mol. Its IUPAC name is N-(2-azidoethyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-azidoethyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 61342320 |
| Molecular Formula | C6H9N5O2S |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | N-(2-azidoethyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | [N-]=[N+]=NCCNC(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C6H9N5O2S/c7-11-9-2-1-8-5(12)4-3-14-6(13)10-4/h4H,1-3H2,(H,8,12)(H,10,13) |
| InChIKey | UWKQVYSEZIFGHC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|