C12H20N2O4S — CID 65284544
4,4-dimethyl-6-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]hexanoic acid (PubChem CID 65284544) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4,4-dimethyl-6-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]hexanoic acid.
| Compound Name | 4,4-dimethyl-6-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 65284544 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4,4-dimethyl-6-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]hexanoic acid |
| SMILES | CC(C)(CCNC(=O)C1CSC(=O)N1)CCC(=O)O |
| InChI | InChI=1S/C12H20N2O4S/c1-12(2,4-3-9(15)16)5-6-13-10(17)8-7-19-11(18)14-8/h8H,3-7H2,1-2H3,(H,13,17)(H,14,18)(H,15,16) |
| InChIKey | XVVJCKHQSUQMBG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|