C8H12N2O4S — CID 60817082
ethyl 2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetate (PubChem CID 60817082) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is ethyl 2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 60817082 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | ethyl 2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C8H12N2O4S/c1-2-14-6(11)3-9-7(12)5-4-15-8(13)10-5/h5H,2-4H2,1H3,(H,9,12)(H,10,13) |
| InChIKey | OISJWRWDRUXFOW-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|