C8H10N4O2S — CID 61004650
2-oxo-N-(1H-pyrazol-4-ylmethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 61004650) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-oxo-N-(1H-pyrazol-4-ylmethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-oxo-N-(1H-pyrazol-4-ylmethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 61004650 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-oxo-N-(1H-pyrazol-4-ylmethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)NCc2cn[nH]c2)CS1 |
| InChI | InChI=1S/C8H10N4O2S/c13-7(6-4-15-8(14)12-6)9-1-5-2-10-11-3-5/h2-3,6H,1,4H2,(H,9,13)(H,10,11)(H,12,14) |
| InChIKey | VMECZZCFYYDGNS-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|