C9H12N2O2S — CID 115668999
2-oxo-N-pent-4-yn-2-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 115668999) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-oxo-N-pent-4-yn-2-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-oxo-N-pent-4-yn-2-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 115668999 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-oxo-N-pent-4-yn-2-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | C#CCC(C)NC(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C9H12N2O2S/c1-3-4-6(2)10-8(12)7-5-14-9(13)11-7/h1,6-7H,4-5H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | XURTXLYPUXUKFT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|