C9H13NO4S — CID 139441407
(2R)-2-acetamido-3-(2-methylprop-2-enoylsulfanyl)propanoic acid (PubChem CID 139441407) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(2-methylprop-2-enoylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(2-methylprop-2-enoylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 139441407 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (2R)-2-acetamido-3-(2-methylprop-2-enoylsulfanyl)propanoic acid |
| SMILES | C=C(C)C(=O)SC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H13NO4S/c1-5(2)9(14)15-4-7(8(12)13)10-6(3)11/h7H,1,4H2,2-3H3,(H,10,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | QUXMTCCICMTZPC-ZETCQYMHSA-N |
| XLogP | 0.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|