C18H27NO6S — CID 118369927
ethyl (2R)-2-acetamido-3-[[(4R,7R,9S,10R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undecan-10-yl]sulfanyl]propanoate (PubChem CID 118369927) has the molecular formula C18H27NO6S and a molecular weight of 385.48 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3-[[(4R,7R,9S,10R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undecan-10-yl]sulfanyl]propanoate.
| Compound Name | ethyl (2R)-2-acetamido-3-[[(4R,7R,9S,10R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undecan-10-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 118369927 |
| Molecular Formula | C18H27NO6S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl (2R)-2-acetamido-3-[[(4R,7R,9S,10R,11S)-11-hydroxy-9-methyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undecan-10-yl]sulfanyl]propanoate |
| SMILES | CCOC(=O)[C@H](CS[C@H]1C2C(=O)O[C@@H]3CC[C@H](C[C@@H]1C)[C@]23O)NC(C)=O |
| InChI | InChI=1S/C18H27NO6S/c1-4-24-16(21)12(19-10(3)20)8-26-15-9(2)7-11-5-6-13-18(11,23)14(15)17(22)25-13/h9,11-15,23H,4-8H2,1-3H3,(H,19,20)/t9-,11+,12-,13+,14?,15+,18+/m0/s1 |
| InChIKey | YZKIYNGFRIOXAA-MZDMZOOCSA-N |
| XLogP | 0.88 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |