C20H33NO8S — CID 142436112
2-(2-ethylpentanoyloxymethoxycarbonylsulfanyl)ethylcarbamoyloxymethyl cyclohexanecarboxylate (PubChem CID 142436112) has the molecular formula C20H33NO8S and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-(2-ethylpentanoyloxymethoxycarbonylsulfanyl)ethylcarbamoyloxymethyl cyclohexanecarboxylate.
| Compound Name | 2-(2-ethylpentanoyloxymethoxycarbonylsulfanyl)ethylcarbamoyloxymethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 142436112 |
| Molecular Formula | C20H33NO8S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-(2-ethylpentanoyloxymethoxycarbonylsulfanyl)ethylcarbamoyloxymethyl cyclohexanecarboxylate |
| SMILES | CCCC(CC)C(=O)OCOC(=O)SCCNC(=O)OCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H33NO8S/c1-3-8-15(4-2)17(22)27-14-29-20(25)30-12-11-21-19(24)28-13-26-18(23)16-9-6-5-7-10-16/h15-16H,3-14H2,1-2H3,(H,21,24) |
| InChIKey | PSJWOPQYSOKPIJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|