C20H30N2O8S — CID 139935510
[N-(cyclohexanecarbonyloxymethoxycarbonyl)-C-methylsulfanylcarbonimidoyl]carbamoyloxymethyl cyclohexanecarboxylate (PubChem CID 139935510) has the molecular formula C20H30N2O8S and a molecular weight of 458.53 g/mol. Its IUPAC name is [N-(cyclohexanecarbonyloxymethoxycarbonyl)-C-methylsulfanylcarbonimidoyl]carbamoyloxymethyl cyclohexanecarboxylate.
| Compound Name | [N-(cyclohexanecarbonyloxymethoxycarbonyl)-C-methylsulfanylcarbonimidoyl]carbamoyloxymethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 139935510 |
| Molecular Formula | C20H30N2O8S |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [N-(cyclohexanecarbonyloxymethoxycarbonyl)-C-methylsulfanylcarbonimidoyl]carbamoyloxymethyl cyclohexanecarboxylate |
| SMILES | CSC(=NC(=O)OCOC(=O)C1CCCCC1)NC(=O)OCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H30N2O8S/c1-31-18(21-19(25)29-12-27-16(23)14-8-4-2-5-9-14)22-20(26)30-13-28-17(24)15-10-6-3-7-11-15/h14-15H,2-13H2,1H3,(H,21,22,25,26) |
| InChIKey | JMRWDSYOANXVRA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|