C23H35NO11S2 — CID 134483005
cyclohexyl (2R)-2-[[2-methyl-2-(propanoyloxymethoxycarbonylsulfanyl)propanoyl]amino]-3-(propanoyloxymethoxycarbonylsulfanyl)propanoate (PubChem CID 134483005) has the molecular formula C23H35NO11S2 and a molecular weight of 565.66 g/mol. Its IUPAC name is cyclohexyl (2R)-2-[[2-methyl-2-(propanoyloxymethoxycarbonylsulfanyl)propanoyl]amino]-3-(propanoyloxymethoxycarbonylsulfanyl)propanoate.
| Compound Name | cyclohexyl (2R)-2-[[2-methyl-2-(propanoyloxymethoxycarbonylsulfanyl)propanoyl]amino]-3-(propanoyloxymethoxycarbonylsulfanyl)propanoate |
|---|---|
| PubChem CID | 134483005 |
| Molecular Formula | C23H35NO11S2 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | cyclohexyl (2R)-2-[[2-methyl-2-(propanoyloxymethoxycarbonylsulfanyl)propanoyl]amino]-3-(propanoyloxymethoxycarbonylsulfanyl)propanoate |
| SMILES | CCC(=O)OCOC(=O)SC[C@H](NC(=O)C(C)(C)SC(=O)OCOC(=O)CC)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C23H35NO11S2/c1-5-17(25)31-13-33-21(29)36-12-16(19(27)35-15-10-8-7-9-11-15)24-20(28)23(3,4)37-22(30)34-14-32-18(26)6-2/h15-16H,5-14H2,1-4H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | YLSMSPYHTOSBCG-INIZCTEOSA-N |
| XLogP | 3.69 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|