C18H28O7S2 — CID 158382350
cyclohexyl (2R)-5-(acetyloxymethoxycarbonylsulfanyl)-5-methyl-4-oxo-2-(sulfanylmethyl)hexanoate (PubChem CID 158382350) has the molecular formula C18H28O7S2 and a molecular weight of 420.55 g/mol. Its IUPAC name is cyclohexyl (2R)-5-(acetyloxymethoxycarbonylsulfanyl)-5-methyl-4-oxo-2-(sulfanylmethyl)hexanoate.
| Compound Name | cyclohexyl (2R)-5-(acetyloxymethoxycarbonylsulfanyl)-5-methyl-4-oxo-2-(sulfanylmethyl)hexanoate |
|---|---|
| PubChem CID | 158382350 |
| Molecular Formula | C18H28O7S2 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | cyclohexyl (2R)-5-(acetyloxymethoxycarbonylsulfanyl)-5-methyl-4-oxo-2-(sulfanylmethyl)hexanoate |
| SMILES | CC(=O)OCOC(=O)SC(C)(C)C(=O)C[C@@H](CS)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C18H28O7S2/c1-12(19)23-11-24-17(22)27-18(2,3)15(20)9-13(10-26)16(21)25-14-7-5-4-6-8-14/h13-14,26H,4-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | UFPOIVKTQVTPJI-ZDUSSCGKSA-N |
| XLogP | 3.54 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|