C27H43NO11S2 — CID 134483199
[(2R)-3-cyclohexyloxy-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-oxopropyl]sulfanylcarbonyloxymethyl 2,2-dimethylpropanoate (PubChem CID 134483199) has the molecular formula C27H43NO11S2 and a molecular weight of 621.77 g/mol. Its IUPAC name is [(2R)-3-cyclohexyloxy-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-oxopropyl]sulfanylcarbonyloxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2R)-3-cyclohexyloxy-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-oxopropyl]sulfanylcarbonyloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134483199 |
| Molecular Formula | C27H43NO11S2 |
| Molecular Weight | 621.77 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | [(2R)-3-cyclohexyloxy-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-oxopropyl]sulfanylcarbonyloxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)SC[C@H](NC(=O)C(C)(C)SC(=O)OCOC(=O)C(C)(C)C)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C27H43NO11S2/c1-25(2,3)21(31)35-15-37-23(33)40-14-18(19(29)39-17-12-10-9-11-13-17)28-20(30)27(7,8)41-24(34)38-16-36-22(32)26(4,5)6/h17-18H,9-16H2,1-8H3,(H,28,30)/t18-/m0/s1 |
| InChIKey | OOEPSCMOCKVMAI-SFHVURJKSA-N |
| XLogP | 4.96 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.77 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|