C18H29NO10S — CID 142436146
[(2R)-3-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-1-methoxy-1-oxopropan-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate (PubChem CID 142436146) has the molecular formula C18H29NO10S and a molecular weight of 451.49 g/mol. Its IUPAC name is [(2R)-3-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-1-methoxy-1-oxopropan-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2R)-3-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-1-methoxy-1-oxopropan-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142436146 |
| Molecular Formula | C18H29NO10S |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [(2R)-3-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-1-methoxy-1-oxopropan-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate |
| SMILES | COC(=O)[C@H](CSC(=O)OCOC(=O)C(C)(C)C)NC(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H29NO10S/c1-17(2,3)13(21)26-9-28-15(23)19-11(12(20)25-7)8-30-16(24)29-10-27-14(22)18(4,5)6/h11H,8-10H2,1-7H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | UWPPIFXVYNIUFG-NSHDSACASA-N |
| XLogP | 2.22 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|