C14H23NO7S2 — CID 134483035
(2R)-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 134483035) has the molecular formula C14H23NO7S2 and a molecular weight of 381.47 g/mol. Its IUPAC name is (2R)-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134483035 |
| Molecular Formula | C14H23NO7S2 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (2R)-2-[[2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(C)C(=O)OCOC(=O)SC(C)(C)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C14H23NO7S2/c1-13(2,3)11(19)21-7-22-12(20)24-14(4,5)10(18)15-8(6-23)9(16)17/h8,23H,6-7H2,1-5H3,(H,15,18)(H,16,17)/t8-/m0/s1 |
| InChIKey | COKXESZRJNJYPE-QMMMGPOBSA-N |
| XLogP | 1.68 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|