C13H22O6 — CID 54163012
(2R,4R)-5-(2,2-dimethylpropanoyloxymethoxy)-2,4-dimethyl-5-oxopentanoic acid (PubChem CID 54163012) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (2R,4R)-5-(2,2-dimethylpropanoyloxymethoxy)-2,4-dimethyl-5-oxopentanoic acid.
| Compound Name | (2R,4R)-5-(2,2-dimethylpropanoyloxymethoxy)-2,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54163012 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R,4R)-5-(2,2-dimethylpropanoyloxymethoxy)-2,4-dimethyl-5-oxopentanoic acid |
| SMILES | C[C@H](C[C@@H](C)C(=O)OCOC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H22O6/c1-8(10(14)15)6-9(2)11(16)18-7-19-12(17)13(3,4)5/h8-9H,6-7H2,1-5H3,(H,14,15)/t8-,9-/m1/s1 |
| InChIKey | OPSSNMAHWTVVPX-RKDXNWHRSA-N |
| XLogP | 1.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|