C19H30O8 — CID 159632713
2-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoethyl]-8,8-dimethyl-4,7-dioxononanoic acid (PubChem CID 159632713) has the molecular formula C19H30O8 and a molecular weight of 386.44 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoethyl]-8,8-dimethyl-4,7-dioxononanoic acid.
| Compound Name | 2-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoethyl]-8,8-dimethyl-4,7-dioxononanoic acid |
|---|---|
| PubChem CID | 159632713 |
| Molecular Formula | C19H30O8 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoethyl]-8,8-dimethyl-4,7-dioxononanoic acid |
| SMILES | CC(C)(C)C(=O)CCC(=O)CC(CC(=O)OCOC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H30O8/c1-18(2,3)14(21)8-7-13(20)9-12(16(23)24)10-15(22)26-11-27-17(25)19(4,5)6/h12H,7-11H2,1-6H3,(H,23,24) |
| InChIKey | MPIIETRLJRGNBD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|