C11H20O3 — CID 10035882
(3,3-dimethyl-2-oxobutyl) 2,2-dimethylpropanoate (PubChem CID 10035882) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2,2-dimethylpropanoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10035882 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20O3/c1-10(2,3)8(12)7-14-9(13)11(4,5)6/h7H2,1-6H3 |
| InChIKey | ZBZNOBBCAFQVCN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |