C9H13F3O4 — CID 90159990
2-(2,2,2-trifluoroacetyl)oxyethyl 2,2-dimethylpropanoate (PubChem CID 90159990) has the molecular formula C9H13F3O4 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroacetyl)oxyethyl 2,2-dimethylpropanoate.
| Compound Name | 2-(2,2,2-trifluoroacetyl)oxyethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90159990 |
| Molecular Formula | C9H13F3O4 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-(2,2,2-trifluoroacetyl)oxyethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O4/c1-8(2,3)6(13)15-4-5-16-7(14)9(10,11)12/h4-5H2,1-3H3 |
| InChIKey | LYBLWOUJEIJTAA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|