C14H13F11O4 — CID 90159965
2-(2,2-dimethylpropanoyloxy)ethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate (PubChem CID 90159965) has the molecular formula C14H13F11O4 and a molecular weight of 454.23 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)ethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate.
| Compound Name | 2-(2,2-dimethylpropanoyloxy)ethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90159965 |
| Molecular Formula | C14H13F11O4 |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)ethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)C(=O)OCCOC(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H13F11O4/c1-8(2,3)6(26)28-4-5-29-7(27)9(15)10(16,17)12(20,21)14(24,25)13(22,23)11(9,18)19/h4-5H2,1-3H3 |
| InChIKey | HBEQBGJEKBHCSA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|