C11H7F11O3 — CID 141293561
2-ethenoxyethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate (PubChem CID 141293561) has the molecular formula C11H7F11O3 and a molecular weight of 396.15 g/mol. Its IUPAC name is 2-ethenoxyethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate.
| Compound Name | 2-ethenoxyethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 141293561 |
| Molecular Formula | C11H7F11O3 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2-ethenoxyethyl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
| SMILES | C=COCCOC(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H7F11O3/c1-2-24-3-4-25-5(23)6(12)7(13,14)9(17,18)11(21,22)10(19,20)8(6,15)16/h2H,1,3-4H2 |
| InChIKey | ZSJQXTOVWQNGBD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|