C36H50O18 — CID 149463478
2-O,3-O,4-O,5-O,6-O-pentakis(2-ethenoxyethyl) 1-O-(2-ethoxyethyl) cyclohexane-1,2,3,4,5,6-hexacarboxylate (PubChem CID 149463478) has the molecular formula C36H50O18 and a molecular weight of 770.78 g/mol. Its IUPAC name is 2-O,3-O,4-O,5-O,6-O-pentakis(2-ethenoxyethyl) 1-O-(2-ethoxyethyl) cyclohexane-1,2,3,4,5,6-hexacarboxylate.
| Compound Name | 2-O,3-O,4-O,5-O,6-O-pentakis(2-ethenoxyethyl) 1-O-(2-ethoxyethyl) cyclohexane-1,2,3,4,5,6-hexacarboxylate |
|---|---|
| PubChem CID | 149463478 |
| Molecular Formula | C36H50O18 |
| Molecular Weight | 770.78 g/mol |
| Exact Mass | 770.30 |
| IUPAC Name | 2-O,3-O,4-O,5-O,6-O-pentakis(2-ethenoxyethyl) 1-O-(2-ethoxyethyl) cyclohexane-1,2,3,4,5,6-hexacarboxylate |
| SMILES | C=COCCOC(=O)C1C(C(=O)OCCOC=C)C(C(=O)OCCOC=C)C(C(=O)OCCOCC)C(C(=O)OCCOC=C)C1C(=O)OCCOC=C |
| InChI | InChI=1S/C36H50O18/c1-7-43-13-19-49-31(37)25-26(32(38)50-20-14-44-8-2)28(34(40)52-22-16-46-10-4)30(36(42)54-24-18-48-12-6)29(35(41)53-23-17-47-11-5)27(25)33(39)51-21-15-45-9-3/h7-11,25-30H,1-5,12-24H2,6H3 |
| InChIKey | YZYVNYGUDFVUOL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.78 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|