C21H30O9 — CID 58220517
tris(2-ethenoxyethyl) cyclohexane-1,3,5-tricarboxylate (PubChem CID 58220517) has the molecular formula C21H30O9 and a molecular weight of 426.46 g/mol. Its IUPAC name is tris(2-ethenoxyethyl) cyclohexane-1,3,5-tricarboxylate.
| Compound Name | tris(2-ethenoxyethyl) cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58220517 |
| Molecular Formula | C21H30O9 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | tris(2-ethenoxyethyl) cyclohexane-1,3,5-tricarboxylate |
| SMILES | C=COCCOC(=O)C1CC(C(=O)OCCOC=C)CC(C(=O)OCCOC=C)C1 |
| InChI | InChI=1S/C21H30O9/c1-4-25-7-10-28-19(22)16-13-17(20(23)29-11-8-26-5-2)15-18(14-16)21(24)30-12-9-27-6-3/h4-6,16-18H,1-3,7-15H2 |
| InChIKey | LYTZHKPFVWPYGQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|