C15H16F10O4 — CID 89280307
2-(2,2-dimethylbutanoyloxy)ethyl 1,2,2,3,3,4,4,5,6,6-decafluorocyclohexane-1-carboxylate (PubChem CID 89280307) has the molecular formula C15H16F10O4 and a molecular weight of 450.27 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl 1,2,2,3,3,4,4,5,6,6-decafluorocyclohexane-1-carboxylate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl 1,2,2,3,3,4,4,5,6,6-decafluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89280307 |
| Molecular Formula | C15H16F10O4 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl 1,2,2,3,3,4,4,5,6,6-decafluorocyclohexane-1-carboxylate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C1(F)C(F)(F)C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H16F10O4/c1-4-10(2,3)8(26)28-5-6-29-9(27)11(17)12(18,19)7(16)13(20,21)15(24,25)14(11,22)23/h7H,4-6H2,1-3H3 |
| InChIKey | IIYFVGDUULOEFS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|