C12H22O5 — CID 59017070
2-(2-oxopropoxymethoxy)ethyl 2,2-dimethylbutanoate (PubChem CID 59017070) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-(2-oxopropoxymethoxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(2-oxopropoxymethoxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59017070 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(2-oxopropoxymethoxy)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOCOCC(C)=O |
| InChI | InChI=1S/C12H22O5/c1-5-12(3,4)11(14)17-7-6-15-9-16-8-10(2)13/h5-9H2,1-4H3 |
| InChIKey | HSHLFVZDCOIUCN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|