C15H20F6O6 — CID 118906556
1-O-[2-(2,2-dimethylpropanoyloxy)ethyl] 5-O-propan-2-yl 2,2,3,3,4,4-hexafluoropentanedioate (PubChem CID 118906556) has the molecular formula C15H20F6O6 and a molecular weight of 410.31 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylpropanoyloxy)ethyl] 5-O-propan-2-yl 2,2,3,3,4,4-hexafluoropentanedioate.
| Compound Name | 1-O-[2-(2,2-dimethylpropanoyloxy)ethyl] 5-O-propan-2-yl 2,2,3,3,4,4-hexafluoropentanedioate |
|---|---|
| PubChem CID | 118906556 |
| Molecular Formula | C15H20F6O6 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-O-[2-(2,2-dimethylpropanoyloxy)ethyl] 5-O-propan-2-yl 2,2,3,3,4,4-hexafluoropentanedioate |
| SMILES | CC(C)OC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)OCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H20F6O6/c1-8(2)27-11(24)14(18,19)15(20,21)13(16,17)10(23)26-7-6-25-9(22)12(3,4)5/h8H,6-7H2,1-5H3 |
| InChIKey | WILWVMTYAKSUCM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|