C11H8F12O4 — CID 158193375
2,2,3,3,4,4-hexafluoro-5-(3,3,4,4,5,5-hexafluorohexoxy)-5-oxopentanoic acid (PubChem CID 158193375) has the molecular formula C11H8F12O4 and a molecular weight of 432.16 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-(3,3,4,4,5,5-hexafluorohexoxy)-5-oxopentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-(3,3,4,4,5,5-hexafluorohexoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 158193375 |
| Molecular Formula | C11H8F12O4 |
| Molecular Weight | 432.16 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-(3,3,4,4,5,5-hexafluorohexoxy)-5-oxopentanoic acid |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C11H8F12O4/c1-6(12,13)10(20,21)7(14,15)2-3-27-5(26)9(18,19)11(22,23)8(16,17)4(24)25/h2-3H2,1H3,(H,24,25) |
| InChIKey | ZMKVMOXYBKAMHV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.16 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|