C8H6F6O6 — CID 164746522
2,2,3,3,4,4-hexafluoro-5-(2-methoxy-2-oxoethoxy)-5-oxopentanoic acid (PubChem CID 164746522) has the molecular formula C8H6F6O6 and a molecular weight of 312.12 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-(2-methoxy-2-oxoethoxy)-5-oxopentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-(2-methoxy-2-oxoethoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 164746522 |
| Molecular Formula | C8H6F6O6 |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-(2-methoxy-2-oxoethoxy)-5-oxopentanoic acid |
| SMILES | COC(=O)COC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C8H6F6O6/c1-19-3(15)2-20-5(18)7(11,12)8(13,14)6(9,10)4(16)17/h2H2,1H3,(H,16,17) |
| InChIKey | LZRSBFRJPTWXPJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|