About (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate
(2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate (PubChem CID 59440623) has the molecular formula C7H12O7S
and a molecular weight of 240.23 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate |
| PubChem CID | 59440623 |
| Molecular Formula | C7H12O7S |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate |
| SMILES | COC(=O)COC(=O)C(C)(C)SOOO |
| InChI | InChI=1S/C7H12O7S/c1-7(2,15-14-13-10)6(9)12-4-5(8)11-3/h10H,4H2,1-3H3 |
| InChIKey | JLFVVHXAYKRFFQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
The IUPAC name of (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate (CID 59440623) is (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate is COC(=O)COC(=O)C(C)(C)SOOO.
What is the InChIKey of (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
The InChIKey is JLFVVHXAYKRFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O7S/c1-7(2,15-14-13-10)6(9)12-4-5(8)11-3/h10H,4H2,1-3H3.
What are the key properties of (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
(2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate has a molecular weight of 240.23 g/mol, XLogP of 0.55, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate is sourced from PubChem (CID 59440623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).