About (2-methoxy-2-oxoethyl) 2-methylpropanoate
(2-methoxy-2-oxoethyl) 2-methylpropanoate (PubChem CID 18740014) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) 2-methylpropanoate |
| PubChem CID | 18740014 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-methylpropanoate |
| SMILES | COC(=O)COC(=O)C(C)C |
| InChI | InChI=1S/C7H12O4/c1-5(2)7(9)11-4-6(8)10-3/h5H,4H2,1-3H3 |
| InChIKey | MACRNXLRDYCHCO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methoxy-2-oxoethyl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) 2-methylpropanoate?
The IUPAC name of (2-methoxy-2-oxoethyl) 2-methylpropanoate (CID 18740014) is (2-methoxy-2-oxoethyl) 2-methylpropanoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 2-methylpropanoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 2-methylpropanoate is COC(=O)COC(=O)C(C)C.
What is the InChIKey of (2-methoxy-2-oxoethyl) 2-methylpropanoate?
The InChIKey is MACRNXLRDYCHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-5(2)7(9)11-4-6(8)10-3/h5H,4H2,1-3H3.
What are the key properties of (2-methoxy-2-oxoethyl) 2-methylpropanoate?
(2-methoxy-2-oxoethyl) 2-methylpropanoate has a molecular weight of 160.17 g/mol, XLogP of 0.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 2-methylpropanoate is sourced from PubChem (CID 18740014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).