About (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate
(2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate (PubChem CID 89276874) has the molecular formula C11H18O6S
and a molecular weight of 278.33 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate |
| PubChem CID | 89276874 |
| Molecular Formula | C11H18O6S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate |
| SMILES | CCSCC(=O)OCC(C)C(=O)OCC(=O)OC |
| InChI | InChI=1S/C11H18O6S/c1-4-18-7-10(13)16-5-8(2)11(14)17-6-9(12)15-3/h8H,4-7H2,1-3H3 |
| InChIKey | UAKYJDWGAFHZKS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate?
The IUPAC name of (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate (CID 89276874) is (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate is CCSCC(=O)OCC(C)C(=O)OCC(=O)OC.
What is the InChIKey of (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate?
The InChIKey is UAKYJDWGAFHZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6S/c1-4-18-7-10(13)16-5-8(2)11(14)17-6-9(12)15-3/h8H,4-7H2,1-3H3.
What are the key properties of (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate?
(2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate has a molecular weight of 278.33 g/mol, XLogP of 0.63, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 3-(2-ethylsulfanylacetyl)oxy-2-methylpropanoate is sourced from PubChem (CID 89276874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).