C16H11F15O6S — CID 59602173
2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-methyl-2-(trioxidanylsulfanyl)propanoate (PubChem CID 59602173) has the molecular formula C16H11F15O6S and a molecular weight of 616.29 g/mol. Its IUPAC name is 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-methyl-2-(trioxidanylsulfanyl)propanoate.
| Compound Name | 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-methyl-2-(trioxidanylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59602173 |
| Molecular Formula | C16H11F15O6S |
| Molecular Weight | 616.29 g/mol |
| Exact Mass | 616.00 |
| IUPAC Name | 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethyl 2-methyl-2-(trioxidanylsulfanyl)propanoate |
| SMILES | CC(C)(SOOO)C(=O)OCCOC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C16H11F15O6S/c1-6(2,38-37-36-33)5(32)34-3-4-35-10-14(26,27)7(17)11(20,21)8(18,15(10,28)29)13(24,25)9(19,12(7,22)23)16(10,30)31/h33H,3-4H2,1-2H3 |
| InChIKey | PZZRZSZMLBEDMI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.29 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|