C17H24F2O7S — CID 59547577
(2-methyl-2-adamantyl) 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxybutanoate (PubChem CID 59547577) has the molecular formula C17H24F2O7S and a molecular weight of 410.44 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxybutanoate.
| Compound Name | (2-methyl-2-adamantyl) 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxybutanoate |
|---|---|
| PubChem CID | 59547577 |
| Molecular Formula | C17H24F2O7S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (2-methyl-2-adamantyl) 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxybutanoate |
| SMILES | CC1(OC(=O)CCCOC(=O)C(F)(F)SOOO)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H24F2O7S/c1-16(12-6-10-5-11(8-12)9-13(16)7-10)24-14(20)3-2-4-23-15(21)17(18,19)27-26-25-22/h10-13,22H,2-9H2,1H3 |
| InChIKey | DBTROVRFZKSUPN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|