C15H21F2O7S- — CID 59814241
[2-[(2-butyl-2-bicyclo[2.2.1]heptanyl)oxy]-2-oxoethyl] 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59814241) has the molecular formula C15H21F2O7S- and a molecular weight of 383.39 g/mol. Its IUPAC name is [2-[(2-butyl-2-bicyclo[2.2.1]heptanyl)oxy]-2-oxoethyl] 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | [2-[(2-butyl-2-bicyclo[2.2.1]heptanyl)oxy]-2-oxoethyl] 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59814241 |
| Molecular Formula | C15H21F2O7S- |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [2-[(2-butyl-2-bicyclo[2.2.1]heptanyl)oxy]-2-oxoethyl] 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | CCCCC1(OC(=O)COC(=O)C(F)(F)SOO[O-])CC2CCC1C2 |
| InChI | InChI=1S/C15H22F2O7S/c1-2-3-6-14(8-10-4-5-11(14)7-10)22-12(18)9-21-13(19)15(16,17)25-24-23-20/h10-11,20H,2-9H2,1H3/p-1 |
| InChIKey | FENFXFHJUYEXFV-UHFFFAOYSA-M |
| XLogP | 2.29 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|