C7H7F4O7S- — CID 59602062
(2-ethoxy-2-oxoethyl) 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate (PubChem CID 59602062) has the molecular formula C7H7F4O7S- and a molecular weight of 311.19 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate.
| Compound Name | (2-ethoxy-2-oxoethyl) 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate |
|---|---|
| PubChem CID | 59602062 |
| Molecular Formula | C7H7F4O7S- |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate |
| SMILES | CCOC(=O)COC(=O)C(F)(SOO[O-])C(F)(F)F |
| InChI | InChI=1S/C7H8F4O7S/c1-2-15-4(12)3-16-5(13)6(8,7(9,10)11)19-18-17-14/h14H,2-3H2,1H3/p-1 |
| InChIKey | HIVFBXQLFYMZOO-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|