C6HF10O5S- — CID 140525103
2,3,3,4,4,5,5,6,6,6-decafluoro-2-oxidoperoxysulfanylhexanoic acid (PubChem CID 140525103) has the molecular formula C6HF10O5S- and a molecular weight of 375.12 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,6-decafluoro-2-oxidoperoxysulfanylhexanoic acid.
| Compound Name | 2,3,3,4,4,5,5,6,6,6-decafluoro-2-oxidoperoxysulfanylhexanoic acid |
|---|---|
| PubChem CID | 140525103 |
| Molecular Formula | C6HF10O5S- |
| Molecular Weight | 375.12 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,6-decafluoro-2-oxidoperoxysulfanylhexanoic acid |
| SMILES | O=C(O)C(F)(SOO[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F10O5S/c7-2(1(17)18,22-21-20-19)3(8,9)4(10,11)5(12,13)6(14,15)16/h19H,(H,17,18)/p-1 |
| InChIKey | UDZFHNMOSMSADQ-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|