C3F5O4S- — CID 58852794
2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride (PubChem CID 58852794) has the molecular formula C3F5O4S- and a molecular weight of 227.09 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride.
| Compound Name | 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride |
|---|---|
| PubChem CID | 58852794 |
| Molecular Formula | C3F5O4S- |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.94 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride |
| SMILES | O=C(F)C(F)(F)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C3HF5O4S/c4-1(9)2(5,6)3(7,8)13-12-11-10/h10H/p-1 |
| InChIKey | HYHZOJVUDUZVEO-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|