2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride

C3F5O4S- — CID 58852794

IUPAC2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride
SMILESO=C(F)C(F)(F)C(F)(F)SOO[O-]
InChIInChI=1S/C3HF5O4S/c4-1(9)2(5,6)3(7,8)13-12-11-10/h10H/p-1
InChIKeyHYHZOJVUDUZVEO-UHFFFAOYSA-M
MW227.09 g/mol
LogP0.58
Rot. Bonds5

About 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride

2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride (PubChem CID 58852794) has the molecular formula C3F5O4S- and a molecular weight of 227.09 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride.

Molecular Properties

Compound Name2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride
PubChem CID58852794
Molecular FormulaC3F5O4S-
Molecular Weight227.09 g/mol
Exact Mass226.94
IUPAC Name2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride
SMILESO=C(F)C(F)(F)C(F)(F)SOO[O-]
InChIInChI=1S/C3HF5O4S/c4-1(9)2(5,6)3(7,8)13-12-11-10/h10H/p-1
InChIKeyHYHZOJVUDUZVEO-UHFFFAOYSA-M
XLogP0.58
TPSA58.59 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.09
LogP ≤ 50.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}

Analyze 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride?
The IUPAC name of 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride (CID 58852794) is 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride.
What is the SMILES notation for 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride?
The canonical SMILES for 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride is O=C(F)C(F)(F)C(F)(F)SOO[O-].
What is the InChIKey of 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride?
The InChIKey is HYHZOJVUDUZVEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C3HF5O4S/c4-1(9)2(5,6)3(7,8)13-12-11-10/h10H/p-1.
What are the key properties of 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride?
2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride has a molecular weight of 227.09 g/mol, XLogP of 0.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3-tetrafluoro-3-oxidoperoxysulfanylpropanoyl fluoride is sourced from PubChem (CID 58852794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).