sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate

C5H4F2NNaO5S — CID 58870511

IUPACsodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate
SMILESN#CCCOC(=O)C(F)(F)SOO[O-].[Na+]
InChIInChI=1S/C5H5F2NO5S.Na/c6-5(7,14-13-12-10)4(9)11-3-1-2-8;/h10H,1,3H2;/q;+1/p-1
InChIKeyAPDSWOAUSOGKDN-UHFFFAOYSA-M
MW251.14 g/mol
LogP-3.09
Rot. Bonds6

About sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate

sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 58870511) has the molecular formula C5H4F2NNaO5S and a molecular weight of 251.14 g/mol. Its IUPAC name is sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.

Molecular Properties

Compound Namesodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate
PubChem CID58870511
Molecular FormulaC5H4F2NNaO5S
Molecular Weight251.14 g/mol
Exact Mass250.97
IUPAC Namesodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate
SMILESN#CCCOC(=O)C(F)(F)SOO[O-].[Na+]
InChIInChI=1S/C5H5F2NO5S.Na/c6-5(7,14-13-12-10)4(9)11-3-1-2-8;/h10H,1,3H2;/q;+1/p-1
InChIKeyAPDSWOAUSOGKDN-UHFFFAOYSA-M
XLogP-3.09
TPSA91.61 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.14
LogP ≤ 5-3.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}

Analyze sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
The IUPAC name of sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (CID 58870511) is sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
What is the SMILES notation for sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
The canonical SMILES for sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate is N#CCCOC(=O)C(F)(F)SOO[O-].[Na+].
What is the InChIKey of sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
The InChIKey is APDSWOAUSOGKDN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5F2NO5S.Na/c6-5(7,14-13-12-10)4(9)11-3-1-2-8;/h10H,1,3H2;/q;+1/p-1.
What are the key properties of sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate has a molecular weight of 251.14 g/mol, XLogP of -3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate is sourced from PubChem (CID 58870511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).