C5H4F2NNaO5S — CID 58870511
sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 58870511) has the molecular formula C5H4F2NNaO5S and a molecular weight of 251.14 g/mol. Its IUPAC name is sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 58870511 |
| Molecular Formula | C5H4F2NNaO5S |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | sodium 2-cyanoethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | N#CCCOC(=O)C(F)(F)SOO[O-].[Na+] |
| InChI | InChI=1S/C5H5F2NO5S.Na/c6-5(7,14-13-12-10)4(9)11-3-1-2-8;/h10H,1,3H2;/q;+1/p-1 |
| InChIKey | APDSWOAUSOGKDN-UHFFFAOYSA-M |
| XLogP | -3.09 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|